C20H26ClFN2O3 — CID 73293242
2-tert-butyl-4-chloro-5-[[4-[1-(3-fluoropropoxy)ethyl]phenyl]methoxy]pyridazin-3-one (PubChem CID 73293242) has the molecular formula C20H26ClFN2O3 and a molecular weight of 396.89 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-[1-(3-fluoropropoxy)ethyl]phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-[1-(3-fluoropropoxy)ethyl]phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 73293242 |
| Molecular Formula | C20H26ClFN2O3 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-[1-(3-fluoropropoxy)ethyl]phenyl]methoxy]pyridazin-3-one |
| SMILES | CC(OCCCF)c1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C20H26ClFN2O3/c1-14(26-11-5-10-22)16-8-6-15(7-9-16)13-27-17-12-23-24(20(2,3)4)19(25)18(17)21/h6-9,12,14H,5,10-11,13H2,1-4H3 |
| InChIKey | QOGPFFNUOQWVGH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|