C19H25ClN2O3 — CID 118229024
2-tert-butyl-4-chloro-5-[[4-[dideuterio(propoxy)methyl]phenyl]methoxy]pyridazin-3-one (PubChem CID 118229024) has the molecular formula C19H25ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-[dideuterio(propoxy)methyl]phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-[dideuterio(propoxy)methyl]phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 118229024 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-[dideuterio(propoxy)methyl]phenyl]methoxy]pyridazin-3-one |
| SMILES | [2H]C([2H])(OCCC)c1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C19H25ClN2O3/c1-5-10-24-12-14-6-8-15(9-7-14)13-25-16-11-21-22(19(2,3)4)18(23)17(16)20/h6-9,11H,5,10,12-13H2,1-4H3/i12D2 |
| InChIKey | FJXFQWCYNOVXRJ-XUWBISKJSA-N |
| XLogP | 4.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |