C20H26BrClN2O4 — CID 118229066
5-[[3-bromo-5-methoxy-4-(propoxymethyl)phenyl]methoxy]-2-tert-butyl-4-chloropyridazin-3-one (PubChem CID 118229066) has the molecular formula C20H26BrClN2O4 and a molecular weight of 473.80 g/mol. Its IUPAC name is 5-[[3-bromo-5-methoxy-4-(propoxymethyl)phenyl]methoxy]-2-tert-butyl-4-chloropyridazin-3-one.
| Compound Name | 5-[[3-bromo-5-methoxy-4-(propoxymethyl)phenyl]methoxy]-2-tert-butyl-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 118229066 |
| Molecular Formula | C20H26BrClN2O4 |
| Molecular Weight | 473.80 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 5-[[3-bromo-5-methoxy-4-(propoxymethyl)phenyl]methoxy]-2-tert-butyl-4-chloropyridazin-3-one |
| SMILES | CCCOCc1c(Br)cc(COc2cnn(C(C)(C)C)c(=O)c2Cl)cc1OC |
| InChI | InChI=1S/C20H26BrClN2O4/c1-6-7-27-12-14-15(21)8-13(9-16(14)26-5)11-28-17-10-23-24(20(2,3)4)19(25)18(17)22/h8-10H,6-7,11-12H2,1-5H3 |
| InChIKey | IOXYOKUUAWORFR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.80 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|