C18H24ClN3O4 — CID 118229049
2-tert-butyl-4-chloro-5-[[2-(3-hydroxypropoxy)-6-methyl-3-pyridinyl]methoxy]pyridazin-3-one (PubChem CID 118229049) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[2-(3-hydroxypropoxy)-6-methyl-3-pyridinyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[2-(3-hydroxypropoxy)-6-methyl-3-pyridinyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 118229049 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[2-(3-hydroxypropoxy)-6-methyl-3-pyridinyl]methoxy]pyridazin-3-one |
| SMILES | Cc1ccc(COc2cnn(C(C)(C)C)c(=O)c2Cl)c(OCCCO)n1 |
| InChI | InChI=1S/C18H24ClN3O4/c1-12-6-7-13(16(21-12)25-9-5-8-23)11-26-14-10-20-22(18(2,3)4)17(24)15(14)19/h6-7,10,23H,5,8-9,11H2,1-4H3 |
| InChIKey | DFIILDVXFZYPAK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|