C34H42O8S — CID 171626339
tert-butyl 2-[4-[(E)-2-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]propanoate (PubChem CID 171626339) has the molecular formula C34H42O8S and a molecular weight of 610.77 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-2-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]propanoate.
| Compound Name | tert-butyl 2-[4-[(E)-2-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 171626339 |
| Molecular Formula | C34H42O8S |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | tert-butyl 2-[4-[(E)-2-[4-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]phenyl]ethenyl]phenyl]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOc2ccc(/C=C/c3ccc(C(C)C(=O)OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H42O8S/c1-26-6-18-32(19-7-26)43(36,37)41-25-23-39-21-20-38-22-24-40-31-16-12-29(13-17-31)9-8-28-10-14-30(15-11-28)27(2)33(35)42-34(3,4)5/h6-19,27H,20-25H2,1-5H3/b9-8+ |
| InChIKey | RCEVOVJVUVGUSQ-CMDGGOBGSA-N |
| XLogP | 6.43 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|