C32H38O6S — CID 171626343
2-[2-[3-[4-[(E)-2-[4-(3-oxobutan-2-yl)phenyl]ethenyl]phenyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 171626343) has the molecular formula C32H38O6S and a molecular weight of 550.72 g/mol. Its IUPAC name is 2-[2-[3-[4-[(E)-2-[4-(3-oxobutan-2-yl)phenyl]ethenyl]phenyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[3-[4-[(E)-2-[4-(3-oxobutan-2-yl)phenyl]ethenyl]phenyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171626343 |
| Molecular Formula | C32H38O6S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-[2-[3-[4-[(E)-2-[4-(3-oxobutan-2-yl)phenyl]ethenyl]phenyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)C(C)c1ccc(/C=C/c2ccc(CCCOCCOCCOS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H38O6S/c1-25-6-18-32(19-7-25)39(34,35)38-24-23-37-22-21-36-20-4-5-28-8-10-29(11-9-28)12-13-30-14-16-31(17-15-30)26(2)27(3)33/h6-19,26H,4-5,20-24H2,1-3H3/b13-12+ |
| InChIKey | PKJZVEZCPAYFAD-OUKQBFOZSA-N |
| XLogP | 6.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|