C33H38N2O8S — CID 89482385
4-cyano-2-[2-[2-[2-[4-[(E)-2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid (PubChem CID 89482385) has the molecular formula C33H38N2O8S and a molecular weight of 622.74 g/mol. Its IUPAC name is 4-cyano-2-[2-[2-[2-[4-[(E)-2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid.
| Compound Name | 4-cyano-2-[2-[2-[2-[4-[(E)-2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89482385 |
| Molecular Formula | C33H38N2O8S |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 4-cyano-2-[2-[2-[2-[4-[(E)-2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethenyl]phenoxy]ethoxy]ethoxy]ethyl]benzenesulfonic acid |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(/C=C/c2ccc(OCCOCCOCCc3cc(C#N)ccc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O8S/c1-33(2,3)43-32(36)35(4)29-12-7-25(8-13-29)5-6-26-9-14-30(15-10-26)42-22-21-41-20-19-40-18-17-28-23-27(24-34)11-16-31(28)44(37,38)39/h5-16,23H,17-22H2,1-4H3,(H,37,38,39)/b6-5+ |
| InChIKey | PENRTOWIYUXSHF-AATRIKPKSA-N |
| XLogP | 6.00 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|