C20H23NO5 — CID 141149139
[4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethenyl]phenyl]-methylcarbamic acid (PubChem CID 141149139) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethenyl]phenyl]-methylcarbamic acid.
| Compound Name | [4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethenyl]phenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 141149139 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [4-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]ethenyl]phenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc(C=Cc2ccc(OCCOCCO)cc2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-21(20(23)24)18-8-4-16(5-9-18)2-3-17-6-10-19(11-7-17)26-15-14-25-13-12-22/h2-11,22H,12-15H2,1H3,(H,23,24) |
| InChIKey | MTRFRUDLDGLSOT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|