C25H31NO7S — CID 16659293
2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethynyl]phenoxy]ethoxy]ethyl methanesulfonate (PubChem CID 16659293) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethynyl]phenoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethynyl]phenoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 16659293 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[2-[4-[2-[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]ethynyl]phenoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(C#Cc2ccc(OCCOCCOS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H31NO7S/c1-25(2,3)33-24(27)26(4)22-12-8-20(9-13-22)6-7-21-10-14-23(15-11-21)31-18-16-30-17-19-32-34(5,28)29/h8-15H,16-19H2,1-5H3 |
| InChIKey | CWOVGBAFDRJXRY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|