C22H24F3NO4S — CID 132583764
N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)but-1-ynyl]benzenesulfonamide (PubChem CID 132583764) has the molecular formula C22H24F3NO4S and a molecular weight of 455.50 g/mol. Its IUPAC name is N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)but-1-ynyl]benzenesulfonamide.
| Compound Name | N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)but-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132583764 |
| Molecular Formula | C22H24F3NO4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-(4-methoxyphenyl)but-1-ynyl]benzenesulfonamide |
| SMILES | CCCCN(C#CC(O)(c1ccc(OC)cc1)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24F3NO4S/c1-4-5-15-26(31(28,29)20-12-6-17(2)7-13-20)16-14-21(27,22(23,24)25)18-8-10-19(30-3)11-9-18/h6-13,27H,4-5,15H2,1-3H3 |
| InChIKey | AQPGNNSRSDQEQR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|