C22H21F6NO3S — CID 132583760
N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]benzenesulfonamide (PubChem CID 132583760) has the molecular formula C22H21F6NO3S and a molecular weight of 493.47 g/mol. Its IUPAC name is N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]benzenesulfonamide.
| Compound Name | N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132583760 |
| Molecular Formula | C22H21F6NO3S |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-butyl-4-methyl-N-[4,4,4-trifluoro-3-hydroxy-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]benzenesulfonamide |
| SMILES | CCCCN(C#CC(O)(c1ccc(C(F)(F)F)cc1)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21F6NO3S/c1-3-4-14-29(33(31,32)19-11-5-16(2)6-12-19)15-13-20(30,22(26,27)28)17-7-9-18(10-8-17)21(23,24)25/h5-12,30H,3-4,14H2,1-2H3 |
| InChIKey | WMQUPTDQDQUOEX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|