C27H30O6S — CID 132549454
methyl 5,5-bis(4-methoxyphenyl)-4-(4-methylphenyl)sulfonylpentanoate (PubChem CID 132549454) has the molecular formula C27H30O6S and a molecular weight of 482.60 g/mol. Its IUPAC name is methyl 5,5-bis(4-methoxyphenyl)-4-(4-methylphenyl)sulfonylpentanoate.
| Compound Name | methyl 5,5-bis(4-methoxyphenyl)-4-(4-methylphenyl)sulfonylpentanoate |
|---|---|
| PubChem CID | 132549454 |
| Molecular Formula | C27H30O6S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | methyl 5,5-bis(4-methoxyphenyl)-4-(4-methylphenyl)sulfonylpentanoate |
| SMILES | COC(=O)CCC(C(c1ccc(OC)cc1)c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H30O6S/c1-19-5-15-24(16-6-19)34(29,30)25(17-18-26(28)33-4)27(20-7-11-22(31-2)12-8-20)21-9-13-23(32-3)14-10-21/h5-16,25,27H,17-18H2,1-4H3 |
| InChIKey | DXRVQRJWDFUMMN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |