C13H19NO5S — CID 10957585
methyl (4S)-5-hydroxy-4-[(4-methylphenyl)sulfonylamino]pentanoate (PubChem CID 10957585) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl (4S)-5-hydroxy-4-[(4-methylphenyl)sulfonylamino]pentanoate.
| Compound Name | methyl (4S)-5-hydroxy-4-[(4-methylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 10957585 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl (4S)-5-hydroxy-4-[(4-methylphenyl)sulfonylamino]pentanoate |
| SMILES | COC(=O)CC[C@@H](CO)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO5S/c1-10-3-6-12(7-4-10)20(17,18)14-11(9-15)5-8-13(16)19-2/h3-4,6-7,11,14-15H,5,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | PDXVNXDVGDCQIS-NSHDSACASA-N |
| XLogP | 0.59 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |