C22H29NO5S — CID 145271692
[(1S)-1-[1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-oxidopyrrolidin-1-ium-3-yl]ethyl] 4-methylbenzenesulfonate (PubChem CID 145271692) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is [(1S)-1-[1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-oxidopyrrolidin-1-ium-3-yl]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-1-[1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-oxidopyrrolidin-1-ium-3-yl]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 145271692 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [(1S)-1-[1-[(1S)-1-(4-methoxyphenyl)ethyl]-1-oxidopyrrolidin-1-ium-3-yl]ethyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc([C@H](C)[N+]2([O-])CCC([C@H](C)OS(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C22H29NO5S/c1-16-5-11-22(12-6-16)29(25,26)28-18(3)20-13-14-23(24,15-20)17(2)19-7-9-21(27-4)10-8-19/h5-12,17-18,20H,13-15H2,1-4H3/t17-,18-,20?,23?/m0/s1 |
| InChIKey | OFSJUDHTBLDFLC-NEPPSICNSA-N |
| XLogP | 4.19 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|