C22H26O4Si — CID 99771242
ethyl 2-[(4R,6R)-2,2-diphenyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]acetate (PubChem CID 99771242) has the molecular formula C22H26O4Si and a molecular weight of 382.53 g/mol. Its IUPAC name is ethyl 2-[(4R,6R)-2,2-diphenyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,6R)-2,2-diphenyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]acetate |
|---|---|
| PubChem CID | 99771242 |
| Molecular Formula | C22H26O4Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl 2-[(4R,6R)-2,2-diphenyl-6-[(E)-prop-1-enyl]-1,3,2-dioxasilinan-4-yl]acetate |
| SMILES | C/C=C/[C@H]1C[C@H](CC(=O)OCC)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C22H26O4Si/c1-3-11-18-16-19(17-22(23)24-4-2)26-27(25-18,20-12-7-5-8-13-20)21-14-9-6-10-15-21/h3,5-15,18-19H,4,16-17H2,1-2H3/b11-3+/t18-,19+/m0/s1 |
| InChIKey | QWFYBRNLHRWLEZ-KUVLTPQXSA-N |
| XLogP | 2.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|