C16H26O2Si2 — CID 10733495
ethyl 2-(1,1,2-trimethyl-2-phenyldisilolan-4-yl)acetate (PubChem CID 10733495) has the molecular formula C16H26O2Si2 and a molecular weight of 306.55 g/mol. Its IUPAC name is ethyl 2-(1,1,2-trimethyl-2-phenyldisilolan-4-yl)acetate.
| Compound Name | ethyl 2-(1,1,2-trimethyl-2-phenyldisilolan-4-yl)acetate |
|---|---|
| PubChem CID | 10733495 |
| Molecular Formula | C16H26O2Si2 |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethyl 2-(1,1,2-trimethyl-2-phenyldisilolan-4-yl)acetate |
| SMILES | CCOC(=O)CC1C[Si](C)(C)[Si](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C16H26O2Si2/c1-5-18-16(17)11-14-12-19(2,3)20(4,13-14)15-9-7-6-8-10-15/h6-10,14H,5,11-13H2,1-4H3 |
| InChIKey | PNXYJBQOFJPZAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|