C17H34O5Si — CID 91499780
ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-(2-hydroxyethyl)-1,3,2-dioxasilinan-4-yl]acetate (PubChem CID 91499780) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-(2-hydroxyethyl)-1,3,2-dioxasilinan-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-(2-hydroxyethyl)-1,3,2-dioxasilinan-4-yl]acetate |
|---|---|
| PubChem CID | 91499780 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-(2-hydroxyethyl)-1,3,2-dioxasilinan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@H](CCO)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H34O5Si/c1-8-20-15(19)12-14-11-13(9-10-18)21-23(22-14,16(2,3)4)17(5,6)7/h13-14,18H,8-12H2,1-7H3/t13-,14+/m0/s1 |
| InChIKey | QFSWLFJTPGLIRH-UONOGXRCSA-N |
| XLogP | 3.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|