C12H18N2O9 — CID 121003728
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-[methoxy(nitroso)amino]oxan-3-yl] acetate (PubChem CID 121003728) has the molecular formula C12H18N2O9 and a molecular weight of 334.28 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[methoxy(nitroso)amino]oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[methoxy(nitroso)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 121003728 |
| Molecular Formula | C12H18N2O9 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-[methoxy(nitroso)amino]oxan-3-yl] acetate |
| SMILES | CON(N=O)[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H18N2O9/c1-6(15)21-9-5-20-12(14(13-18)19-4)11(23-8(3)17)10(9)22-7(2)16/h9-12H,5H2,1-4H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | NDHGKIQXKPMHTQ-WRWGMCAJSA-N |
| XLogP | -0.32 |
| TPSA | 130.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|