C12H16N2O7S — CID 135050904
[(3R,5S,6S)-4,5-diacetyloxy-6-[2-(sulfanylidenemethylidene)hydrazinyl]oxan-3-yl] acetate (PubChem CID 135050904) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is [(3R,5S,6S)-4,5-diacetyloxy-6-[2-(sulfanylidenemethylidene)hydrazinyl]oxan-3-yl] acetate.
| Compound Name | [(3R,5S,6S)-4,5-diacetyloxy-6-[2-(sulfanylidenemethylidene)hydrazinyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 135050904 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [(3R,5S,6S)-4,5-diacetyloxy-6-[2-(sulfanylidenemethylidene)hydrazinyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](OC(C)=O)CO[C@H](NN=C=S)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H16N2O7S/c1-6(15)19-9-4-18-12(14-13-5-22)11(21-8(3)17)10(9)20-7(2)16/h9-12,14H,4H2,1-3H3/t9-,10?,11+,12+/m1/s1 |
| InChIKey | HOSSXWZDFXWQLH-VIVKNYSDSA-N |
| XLogP | -0.25 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|