C20H23NO10 — CID 23253965
acetyl 4-[[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]amino]benzoate (PubChem CID 23253965) has the molecular formula C20H23NO10 and a molecular weight of 437.40 g/mol. Its IUPAC name is acetyl 4-[[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]amino]benzoate.
| Compound Name | acetyl 4-[[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 23253965 |
| Molecular Formula | C20H23NO10 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | acetyl 4-[[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]amino]benzoate |
| SMILES | CC(=O)OC(=O)c1ccc(N[C@H]2OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C20H23NO10/c1-10(22)28-16-9-27-19(18(30-12(3)24)17(16)29-11(2)23)21-15-7-5-14(6-8-15)20(26)31-13(4)25/h5-8,16-19,21H,9H2,1-4H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | DLOSINFLCLAHKV-MKXGPGLRSA-N |
| XLogP | 0.95 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|