C11H18N2O9S — CID 102160842
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-(sulfamoylamino)oxan-3-yl] acetate (PubChem CID 102160842) has the molecular formula C11H18N2O9S and a molecular weight of 354.34 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(sulfamoylamino)oxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(sulfamoylamino)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102160842 |
| Molecular Formula | C11H18N2O9S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-(sulfamoylamino)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](NS(N)(=O)=O)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H18N2O9S/c1-5(14)20-8-4-19-11(13-23(12,17)18)10(22-7(3)16)9(8)21-6(2)15/h8-11,13H,4H2,1-3H3,(H2,12,17,18)/t8-,9-,10+,11-/m0/s1 |
| InChIKey | RUKDYPKCJQMDNH-MMWGEVLESA-N |
| XLogP | -2.07 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|