C12H19NO4 — CID 163894504
[(7S)-2,6,7-trimethyl-3a,5,6,7,8,8a-hexahydrooxepino[3,2-d][1,3]oxazol-8-yl] acetate (PubChem CID 163894504) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is [(7S)-2,6,7-trimethyl-3a,5,6,7,8,8a-hexahydrooxepino[3,2-d][1,3]oxazol-8-yl] acetate.
| Compound Name | [(7S)-2,6,7-trimethyl-3a,5,6,7,8,8a-hexahydrooxepino[3,2-d][1,3]oxazol-8-yl] acetate |
|---|---|
| PubChem CID | 163894504 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [(7S)-2,6,7-trimethyl-3a,5,6,7,8,8a-hexahydrooxepino[3,2-d][1,3]oxazol-8-yl] acetate |
| SMILES | CC(=O)OC1C2N=C(C)OC2OCC(C)[C@@H]1C |
| InChI | InChI=1S/C12H19NO4/c1-6-5-15-12-10(13-8(3)16-12)11(7(6)2)17-9(4)14/h6-7,10-12H,5H2,1-4H3/t6?,7-,10?,11?,12?/m0/s1 |
| InChIKey | QELDQKCZZALZJT-VYNZSNPASA-N |
| XLogP | 1.36 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |