C14H21NO5 — CID 161120921
(5-acetyloxy-2,4-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methyl acetate (PubChem CID 161120921) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is (5-acetyloxy-2,4-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methyl acetate.
| Compound Name | (5-acetyloxy-2,4-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methyl acetate |
|---|---|
| PubChem CID | 161120921 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (5-acetyloxy-2,4-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methyl acetate |
| SMILES | CC(=O)OCC1CC2OC(C)=NC2C(C)C1OC(C)=O |
| InChI | InChI=1S/C14H21NO5/c1-7-13-12(19-8(2)15-13)5-11(6-18-9(3)16)14(7)20-10(4)17/h7,11-14H,5-6H2,1-4H3 |
| InChIKey | VDAVTVDIQARNED-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |