C15H21NO7 — CID 134386732
[(5S,7aS)-4,5-diacetyloxy-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl acetate (PubChem CID 134386732) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is [(5S,7aS)-4,5-diacetyloxy-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl acetate.
| Compound Name | [(5S,7aS)-4,5-diacetyloxy-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 134386732 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [(5S,7aS)-4,5-diacetyloxy-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1C[C@@H]2OC(C)=NC2C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H21NO7/c1-7-16-13-12(21-7)5-11(6-20-8(2)17)14(22-9(3)18)15(13)23-10(4)19/h11-15H,5-6H2,1-4H3/t11?,12-,13?,14-,15?/m0/s1 |
| InChIKey | IXTZSRZBADGHJJ-DWFNKSCCSA-N |
| XLogP | 0.62 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|