C10H15NO6 — CID 122419041
[(3aR,5R,6R,7R,7aR)-6-hydroxy-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-7-yl] acetate (PubChem CID 122419041) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aR)-6-hydroxy-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-7-yl] acetate.
| Compound Name | [(3aR,5R,6R,7R,7aR)-6-hydroxy-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-7-yl] acetate |
|---|---|
| PubChem CID | 122419041 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | [(3aR,5R,6R,7R,7aR)-6-hydroxy-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@@H](CO)O[C@@H]2OC(C)=N[C@@H]21 |
| InChI | InChI=1S/C10H15NO6/c1-4-11-7-9(16-5(2)13)8(14)6(3-12)17-10(7)15-4/h6-10,12,14H,3H2,1-2H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | XSIFBKUFAHOYNN-SPFKKGSWSA-N |
| XLogP | -1.19 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |