C15H23NO8 — CID 158999894
[(3aR,5R,6R,7R,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate;methane (PubChem CID 158999894) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate;methane.
| Compound Name | [(3aR,5R,6R,7R,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate;methane |
|---|---|
| PubChem CID | 158999894 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [(3aR,5R,6R,7R,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate;methane |
| SMILES | C.CC(=O)OC[C@H]1O[C@@H]2OC(C)=N[C@@H]2[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO8.CH4/c1-6-15-11-13(22-9(4)18)12(21-8(3)17)10(5-19-7(2)16)23-14(11)20-6;/h10-14H,5H2,1-4H3;1H4/t10-,11-,12+,13-,14+;/m1./s1 |
| InChIKey | JRFCSNJQWBOLHX-SXQUUHMTSA-N |
| XLogP | 0.59 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|