C14H16Cl3NO8 — CID 72772902
[6,7-diacetyloxy-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate (PubChem CID 72772902) has the molecular formula C14H16Cl3NO8 and a molecular weight of 432.64 g/mol. Its IUPAC name is [6,7-diacetyloxy-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate.
| Compound Name | [6,7-diacetyloxy-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 72772902 |
| Molecular Formula | C14H16Cl3NO8 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | [6,7-diacetyloxy-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC2OC(C(Cl)(Cl)Cl)=NC2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H16Cl3NO8/c1-5(19)22-4-8-10(23-6(2)20)11(24-7(3)21)9-12(25-8)26-13(18-9)14(15,16)17/h8-12H,4H2,1-3H3 |
| InChIKey | RZRRUSISTGOCFI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|