C13H19NO6 — CID 174135341
[(6R,7R)-6-acetyloxy-2,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate (PubChem CID 174135341) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is [(6R,7R)-6-acetyloxy-2,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate.
| Compound Name | [(6R,7R)-6-acetyloxy-2,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 174135341 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [(6R,7R)-6-acetyloxy-2,7-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC2OC(C)=NC2[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H19NO6/c1-6-11-13(18-7(2)14-11)20-10(5-17-8(3)15)12(6)19-9(4)16/h6,10-13H,5H2,1-4H3/t6-,10?,11?,12-,13?/m1/s1 |
| InChIKey | DZOLALBYHREPIU-QETCCTFBSA-N |
| XLogP | 0.66 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |