C14H21BrO6 — CID 66603334
(2,4-diacetyloxy-5-bromo-3-methylcyclohexyl)methyl acetate (PubChem CID 66603334) has the molecular formula C14H21BrO6 and a molecular weight of 365.22 g/mol. Its IUPAC name is (2,4-diacetyloxy-5-bromo-3-methylcyclohexyl)methyl acetate.
| Compound Name | (2,4-diacetyloxy-5-bromo-3-methylcyclohexyl)methyl acetate |
|---|---|
| PubChem CID | 66603334 |
| Molecular Formula | C14H21BrO6 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (2,4-diacetyloxy-5-bromo-3-methylcyclohexyl)methyl acetate |
| SMILES | CC(=O)OCC1CC(Br)C(OC(C)=O)C(C)C1OC(C)=O |
| InChI | InChI=1S/C14H21BrO6/c1-7-13(20-9(3)17)11(6-19-8(2)16)5-12(15)14(7)21-10(4)18/h7,11-14H,5-6H2,1-4H3 |
| InChIKey | ICTAPIKFMJLGRM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|