C14H16N2O7S2 — CID 101063858
[(2S,3S,4S,5R,6R)-4,5-diacetyloxy-6-isothiocyanato-2-(thiocyanatomethyl)oxan-3-yl] acetate (PubChem CID 101063858) has the molecular formula C14H16N2O7S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-4,5-diacetyloxy-6-isothiocyanato-2-(thiocyanatomethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-4,5-diacetyloxy-6-isothiocyanato-2-(thiocyanatomethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101063858 |
| Molecular Formula | C14H16N2O7S2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-4,5-diacetyloxy-6-isothiocyanato-2-(thiocyanatomethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=C=S)O[C@H](CSC#N)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H16N2O7S2/c1-7(17)20-11-10(4-25-5-15)23-14(16-6-24)13(22-9(3)19)12(11)21-8(2)18/h10-14H,4H2,1-3H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | UMIMFGGWYGWLQR-RKQHYHRCSA-N |
| XLogP | 0.82 |
| TPSA | 124.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|