C21H31NO10S2 — CID 46196923
[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-isothiocyanatopropoxy)propylsulfanyl]oxan-2-yl]methyl acetate (PubChem CID 46196923) has the molecular formula C21H31NO10S2 and a molecular weight of 521.61 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-isothiocyanatopropoxy)propylsulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-isothiocyanatopropoxy)propylsulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46196923 |
| Molecular Formula | C21H31NO10S2 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-isothiocyanatopropoxy)propylsulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](SCCCOCCCN=C=S)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H31NO10S2/c1-13(23)28-11-17-18(29-14(2)24)19(30-15(3)25)20(31-16(4)26)21(32-17)34-10-6-9-27-8-5-7-22-12-33/h17-21H,5-11H2,1-4H3/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | QBEAOTGLSRZUTL-CRSSMBPESA-N |
| XLogP | 1.70 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|