C18H26O7 — CID 10498319
ethyl (E)-3-[(2S,3S,4R,5R,6R)-3,5-diacetyloxy-4-methyl-6-prop-2-enyloxan-2-yl]prop-2-enoate (PubChem CID 10498319) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S,4R,5R,6R)-3,5-diacetyloxy-4-methyl-6-prop-2-enyloxan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S,4R,5R,6R)-3,5-diacetyloxy-4-methyl-6-prop-2-enyloxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10498319 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl (E)-3-[(2S,3S,4R,5R,6R)-3,5-diacetyloxy-4-methyl-6-prop-2-enyloxan-2-yl]prop-2-enoate |
| SMILES | C=CC[C@H]1O[C@@H](/C=C/C(=O)OCC)[C@@H](OC(C)=O)[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O7/c1-6-8-14-17(23-12(4)19)11(3)18(24-13(5)20)15(25-14)9-10-16(21)22-7-2/h6,9-11,14-15,17-18H,1,7-8H2,2-5H3/b10-9+/t11-,14-,15+,17-,18+/m1/s1 |
| InChIKey | CQTYGGORVNSXPC-KZNWXITBSA-N |
| XLogP | 1.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|