C11H18O6 — CID 90368674
[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enyloxan-3-yl] acetate (PubChem CID 90368674) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 90368674 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CC[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C11H18O6/c1-3-4-7-11(16-6(2)13)10(15)9(14)8(5-12)17-7/h3,7-12,14-15H,1,4-5H2,2H3/t7-,8-,9-,10+,11-/m1/s1 |
| InChIKey | DBNKPESFBQNQHB-MVCUBJFGSA-N |
| XLogP | -1.02 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|