C13H22O4 — CID 58537544
[(3S,5R,6S)-2,4,5-trimethyl-6-prop-2-enoxyoxan-3-yl] acetate (PubChem CID 58537544) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is [(3S,5R,6S)-2,4,5-trimethyl-6-prop-2-enoxyoxan-3-yl] acetate.
| Compound Name | [(3S,5R,6S)-2,4,5-trimethyl-6-prop-2-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 58537544 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(3S,5R,6S)-2,4,5-trimethyl-6-prop-2-enoxyoxan-3-yl] acetate |
| SMILES | C=CCO[C@H]1OC(C)[C@@H](OC(C)=O)C(C)[C@H]1C |
| InChI | InChI=1S/C13H22O4/c1-6-7-15-13-9(3)8(2)12(10(4)16-13)17-11(5)14/h6,8-10,12-13H,1,7H2,2-5H3/t8?,9-,10?,12+,13+/m1/s1 |
| InChIKey | CGZXLSWTSCBUAW-RIEJWSOOSA-N |
| XLogP | 2.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|