C15H21NaO11S — CID 90661229
sodium (3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl)methanesulfonate (PubChem CID 90661229) has the molecular formula C15H21NaO11S and a molecular weight of 432.38 g/mol. Its IUPAC name is sodium (3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl)methanesulfonate.
| Compound Name | sodium (3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl)methanesulfonate |
|---|---|
| PubChem CID | 90661229 |
| Molecular Formula | C15H21NaO11S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | sodium (3,4,5-triacetyloxy-6-prop-2-enoxyoxan-2-yl)methanesulfonate |
| SMILES | C=CCOC1OC(CS(=O)(=O)[O-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.[Na+] |
| InChI | InChI=1S/C15H22O11S.Na/c1-5-6-22-15-14(25-10(4)18)13(24-9(3)17)12(23-8(2)16)11(26-15)7-27(19,20)21;/h5,11-15H,1,6-7H2,2-4H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | PNJVGLAGVJHKMH-UHFFFAOYSA-M |
| XLogP | -3.74 |
| TPSA | 154.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|