C23H36O13 — CID 102115792
[(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3-hydroxy-4,5-dimethoxy-6-prop-2-enoxyoxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate (PubChem CID 102115792) has the molecular formula C23H36O13 and a molecular weight of 520.53 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3-hydroxy-4,5-dimethoxy-6-prop-2-enoxyoxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3-hydroxy-4,5-dimethoxy-6-prop-2-enoxyoxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 102115792 |
| Molecular Formula | C23H36O13 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[(2R,3R,4S,5R,6S)-3-hydroxy-4,5-dimethoxy-6-prop-2-enoxyoxan-2-yl]methoxy]-2-methyloxan-3-yl] acetate |
| SMILES | C=CCO[C@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](O)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C23H36O13/c1-8-9-30-22-20(29-7)18(28-6)16(27)15(36-22)10-31-23-21(35-14(5)26)19(34-13(4)25)17(11(2)32-23)33-12(3)24/h8,11,15-23,27H,1,9-10H2,2-7H3/t11-,15+,16+,17-,18-,19+,20+,21+,22-,23+/m0/s1 |
| InChIKey | YUKHMFUIUFUDFR-QISDLSEBSA-N |
| XLogP | -0.14 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|