C21H32O14 — CID 162646051
[(2R,3S,4S,5R,6R)-3,4-dihydroxy-6-methoxy-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162646051) has the molecular formula C21H32O14 and a molecular weight of 508.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4-dihydroxy-6-methoxy-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4-dihydroxy-6-methoxy-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162646051 |
| Molecular Formula | C21H32O14 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4-dihydroxy-6-methoxy-5-[(2S,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H32O14/c1-8-16(31-10(3)23)18(32-11(4)24)19(33-12(5)25)21(30-8)35-17-15(27)14(26)13(7-29-9(2)22)34-20(17)28-6/h8,13-21,26-27H,7H2,1-6H3/t8-,13+,14+,15-,16-,17+,18+,19+,20+,21-/m0/s1 |
| InChIKey | YFCBRNUVXSZGFY-WUCFHBHESA-N |
| XLogP | -1.43 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|