C16H26O2 — CID 11776908
[(1S,3R,4S,6S)-1-butyl-4-prop-2-enyl-3-bicyclo[4.1.0]heptanyl] acetate (PubChem CID 11776908) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is [(1S,3R,4S,6S)-1-butyl-4-prop-2-enyl-3-bicyclo[4.1.0]heptanyl] acetate.
| Compound Name | [(1S,3R,4S,6S)-1-butyl-4-prop-2-enyl-3-bicyclo[4.1.0]heptanyl] acetate |
|---|---|
| PubChem CID | 11776908 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [(1S,3R,4S,6S)-1-butyl-4-prop-2-enyl-3-bicyclo[4.1.0]heptanyl] acetate |
| SMILES | C=CC[C@H]1C[C@H]2C[C@@]2(CCCC)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H26O2/c1-4-6-8-16-10-14(16)9-13(7-5-2)15(11-16)18-12(3)17/h5,13-15H,2,4,6-11H2,1,3H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | BZBFJEVJHJRXDV-JONQDZQNSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|