C26H33FN4O4 — CID 69315476
benzyl N-[1-[[1-(2-amino-4-fluorophenyl)-3-hydroxypiperidin-4-yl]carbamoyl]cyclohexyl]carbamate (PubChem CID 69315476) has the molecular formula C26H33FN4O4 and a molecular weight of 484.57 g/mol. Its IUPAC name is benzyl N-[1-[[1-(2-amino-4-fluorophenyl)-3-hydroxypiperidin-4-yl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[1-[[1-(2-amino-4-fluorophenyl)-3-hydroxypiperidin-4-yl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 69315476 |
| Molecular Formula | C26H33FN4O4 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | benzyl N-[1-[[1-(2-amino-4-fluorophenyl)-3-hydroxypiperidin-4-yl]carbamoyl]cyclohexyl]carbamate |
| SMILES | Nc1cc(F)ccc1N1CCC(NC(=O)C2(NC(=O)OCc3ccccc3)CCCCC2)C(O)C1 |
| InChI | InChI=1S/C26H33FN4O4/c27-19-9-10-22(20(28)15-19)31-14-11-21(23(32)16-31)29-24(33)26(12-5-2-6-13-26)30-25(34)35-17-18-7-3-1-4-8-18/h1,3-4,7-10,15,21,23,32H,2,5-6,11-14,16-17,28H2,(H,29,33)(H,30,34) |
| InChIKey | PYBYSJQZZIXYRL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|