C13H28O4Si2 — CID 122210381
3,9,9,12,12-pentamethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane (PubChem CID 122210381) has the molecular formula C13H28O4Si2 and a molecular weight of 304.53 g/mol. Its IUPAC name is 3,9,9,12,12-pentamethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane.
| Compound Name | 3,9,9,12,12-pentamethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane |
|---|---|
| PubChem CID | 122210381 |
| Molecular Formula | C13H28O4Si2 |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3,9,9,12,12-pentamethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane |
| SMILES | CC1CCC2(CC1)OO[Si](C)(C)CC[Si](C)(C)OO2 |
| InChI | InChI=1S/C13H28O4Si2/c1-12-6-8-13(9-7-12)14-16-18(2,3)10-11-19(4,5)17-15-13/h12H,6-11H2,1-5H3 |
| InChIKey | YKNFVHHTBQDSPV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|