C11H18O3 — CID 143254368
3-ethenyl-9-methyl-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 143254368) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-ethenyl-9-methyl-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-ethenyl-9-methyl-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 143254368 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-ethenyl-9-methyl-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | C=CC1COC2(CCC(C)CC2)OO1 |
| InChI | InChI=1S/C11H18O3/c1-3-10-8-12-11(14-13-10)6-4-9(2)5-7-11/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | XHFNOWQDFGVJDO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|