C14H24N2O3 — CID 97337864
1-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-3-prop-2-enylurea (PubChem CID 97337864) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-3-prop-2-enylurea.
| Compound Name | 1-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 97337864 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC[C@H]1COC2(CCC(C)CC2)O1 |
| InChI | InChI=1S/C14H24N2O3/c1-3-8-15-13(17)16-9-12-10-18-14(19-12)6-4-11(2)5-7-14/h3,11-12H,1,4-10H2,2H3,(H2,15,16,17)/t11?,12-,14?/m0/s1 |
| InChIKey | UITPGNVKOVMYHF-LXVYMNJGSA-N |
| XLogP | 1.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|