C20H37IN4O4 — CID 110034702
N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110034702) has the molecular formula C20H37IN4O4 and a molecular weight of 524.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110034702 |
| Molecular Formula | C20H37IN4O4 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(oxolan-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC1CCC2(CC1)OCC(CN/C(=N/CC(=O)N(C)C)NCC1CCCO1)O2.I |
| InChI | InChI=1S/C20H36N4O4.HI/c1-15-6-8-20(9-7-15)27-14-17(28-20)12-22-19(23-13-18(25)24(2)3)21-11-16-5-4-10-26-16;/h15-17H,4-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZYJLRVBIAVYXBY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|