C19H34N4O5 — CID 110036111
N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110036111) has the molecular formula C19H34N4O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036111 |
| Molecular Formula | C19H34N4O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | N,N-dimethyl-2-[[(oxan-2-ylmethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1CCCCO1)NCC1COC2(CCOCC2)O1 |
| InChI | InChI=1S/C19H34N4O5/c1-23(2)17(24)13-22-18(20-11-15-5-3-4-8-26-15)21-12-16-14-27-19(28-16)6-9-25-10-7-19/h15-16H,3-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | VQUKMLNCINDBGV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|