C21H41IN4O4 — CID 110034128
2-[[(2-ethylhexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034128) has the molecular formula C21H41IN4O4 and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-[[(2-ethylhexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-ethylhexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034128 |
| Molecular Formula | C21H41IN4O4 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2-[[(2-ethylhexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N\CC(=O)N(C)C)NCC1COC2(CCOCC2)O1.I |
| InChI | InChI=1S/C21H40N4O4.HI/c1-5-7-8-17(6-2)13-22-20(24-15-19(26)25(3)4)23-14-18-16-28-21(29-18)9-11-27-12-10-21;/h17-18H,5-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | JMCJFEORYRDXRB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|