C17H30N4O4 — CID 110036095
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110036095) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036095 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]acetamide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NCC1COC2(CCOCC2)O1 |
| InChI | InChI=1S/C17H30N4O4/c1-13(2)9-18-16(20-11-15(22)21(3)4)19-10-14-12-24-17(25-14)5-7-23-8-6-17/h14H,1,5-12H2,2-4H3,(H2,18,19,20) |
| InChIKey | KXRGJTBMBPBFMN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|