C19H30N4O5 — CID 110051362
2-[[[2-(furan-2-yl)ethylamino]-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110051362) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110051362 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccco1)NCC1COC2(CCOCC2)O1 |
| InChI | InChI=1S/C19H30N4O5/c1-23(2)17(24)13-22-18(20-8-5-15-4-3-9-26-15)21-12-16-14-27-19(28-16)6-10-25-11-7-19/h3-4,9,16H,5-8,10-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | AWQOHTWIGORQOM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|