C24H39IN4O4 — CID 110037082
2-[[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037082) has the molecular formula C24H39IN4O4 and a molecular weight of 574.50 g/mol. Its IUPAC name is 2-[[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037082 |
| Molecular Formula | C24H39IN4O4 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 2-[[(1,4-dioxaspiro[4.6]undecan-3-ylmethylamino)-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N\CC(=O)N(C)C)NCC2COC3(CCCCCC3)O2)cc1.I |
| InChI | InChI=1S/C24H38N4O4.HI/c1-28(2)22(29)17-27-23(25-15-12-19-8-10-20(30-3)11-9-19)26-16-21-18-31-24(32-21)13-6-4-5-7-14-24;/h8-11,21H,4-7,12-18H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | PDEMTSQUEISGPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|