C16H31IN4O5 — CID 110035150
2-[[(2-methoxyethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035150) has the molecular formula C16H31IN4O5 and a molecular weight of 486.35 g/mol. Its IUPAC name is 2-[[(2-methoxyethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(2-methoxyethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035150 |
| Molecular Formula | C16H31IN4O5 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-[[(2-methoxyethylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\CC(=O)N(C)C)NCC1COC2(CCOCC2)O1.I |
| InChI | InChI=1S/C16H30N4O5.HI/c1-20(2)14(21)11-19-15(17-6-9-22-3)18-10-13-12-24-16(25-13)4-7-23-8-5-16;/h13H,4-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | YJWDFJDLQVBSEL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|