C19H34N4O4 — CID 110036093
2-[[(cyclohexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110036093) has the molecular formula C19H34N4O4 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[[(cyclohexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(cyclohexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110036093 |
| Molecular Formula | C19H34N4O4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 2-[[(cyclohexylamino)-(1,4,8-trioxaspiro[4.5]decan-3-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCC1COC2(CCOCC2)O1)NC1CCCCC1 |
| InChI | InChI=1S/C19H34N4O4/c1-23(2)17(24)13-21-18(22-15-6-4-3-5-7-15)20-12-16-14-26-19(27-16)8-10-25-11-9-19/h15-16H,3-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | OYPSETDIZZRFEI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|